About tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate
tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate (PubChem CID 70670538) has the molecular formula C11H16O6
and a molecular weight of 244.24 g/mol. Its IUPAC name is tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate.
Molecular Properties
| Compound Name | tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate |
| PubChem CID | 70670538 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate |
| SMILES | C=C1OC(C(O)C(=O)OC(C)(C)C)C(O)=C1O |
| InChI | InChI=1S/C11H16O6/c1-5-6(12)7(13)9(16-5)8(14)10(15)17-11(2,3)4/h8-9,12-14H,1H2,2-4H3 |
| InChIKey | FUFIUVLUYHUQKZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate?
The IUPAC name of tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate (CID 70670538) is tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate.
What is the SMILES notation for tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate?
The canonical SMILES for tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate is C=C1OC(C(O)C(=O)OC(C)(C)C)C(O)=C1O.
What is the InChIKey of tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate?
The InChIKey is FUFIUVLUYHUQKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O6/c1-5-6(12)7(13)9(16-5)8(14)10(15)17-11(2,3)4/h8-9,12-14H,1H2,2-4H3.
What are the key properties of tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate?
tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate has a molecular weight of 244.24 g/mol, XLogP of 0.93, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyacetate is sourced from PubChem (CID 70670538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).