C9H10O5 — CID 164578056
ethyl 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate (PubChem CID 164578056) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is ethyl 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate.
| Compound Name | ethyl 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 164578056 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | ethyl 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C12C=CC(O)=C(O)C1O2 |
| InChI | InChI=1S/C9H10O5/c1-2-13-8(12)9-4-3-5(10)6(11)7(9)14-9/h3-4,7,10-11H,2H2,1H3 |
| InChIKey | NCADCYZMQQTYGB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|