C9H7BrFN5 — CID 141178204
1-(2-bromo-5-fluorophenyl)-5-methyl-1,2,4-triazole;molecular nitrogen (PubChem CID 141178204) has the molecular formula C9H7BrFN5 and a molecular weight of 284.09 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-5-methyl-1,2,4-triazole;molecular nitrogen.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-5-methyl-1,2,4-triazole;molecular nitrogen |
|---|---|
| PubChem CID | 141178204 |
| Molecular Formula | C9H7BrFN5 |
| Molecular Weight | 284.09 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-5-methyl-1,2,4-triazole;molecular nitrogen |
| SMILES | Cc1ncnn1-c1cc(F)ccc1Br.N#N |
| InChI | InChI=1S/C9H7BrFN3.N2/c1-6-12-5-13-14(6)9-4-7(11)2-3-8(9)10;1-2/h2-5H,1H3; |
| InChIKey | ZDUYYBICJLISBX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.09 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|