C10H12FN5 — CID 71069724
[4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methylhydrazine (PubChem CID 71069724) has the molecular formula C10H12FN5 and a molecular weight of 221.24 g/mol. Its IUPAC name is [4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methylhydrazine.
| Compound Name | [4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methylhydrazine |
|---|---|
| PubChem CID | 71069724 |
| Molecular Formula | C10H12FN5 |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | [4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methylhydrazine |
| SMILES | Cc1ncnn1-c1cc(F)ccc1CNN |
| InChI | InChI=1S/C10H12FN5/c1-7-13-6-15-16(7)10-4-9(11)3-2-8(10)5-14-12/h2-4,6,14H,5,12H2,1H3 |
| InChIKey | SDFXOEAPGUBWRW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|