C12H16N2O4 — CID 141178984
(2R,3R,4S,5R)-2-[3-(3-aminoprop-1-ynyl)pyrrol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 141178984) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[3-(3-aminoprop-1-ynyl)pyrrol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[3-(3-aminoprop-1-ynyl)pyrrol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 141178984 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (2R,3R,4S,5R)-2-[3-(3-aminoprop-1-ynyl)pyrrol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NCC#Cc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C12H16N2O4/c13-4-1-2-8-3-5-14(6-8)12-11(17)10(16)9(7-15)18-12/h3,5-6,9-12,15-17H,4,7,13H2/t9-,10-,11-,12-/m1/s1 |
| InChIKey | UDTFXNAGRPLJJG-DDHJBXDOSA-N |
| XLogP | -1.59 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|