C16H33NO5 — CID 141179041
ethane;ethyl 4-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate;formic acid (PubChem CID 141179041) has the molecular formula C16H33NO5 and a molecular weight of 319.44 g/mol. Its IUPAC name is ethane;ethyl 4-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate;formic acid.
| Compound Name | ethane;ethyl 4-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate;formic acid |
|---|---|
| PubChem CID | 141179041 |
| Molecular Formula | C16H33NO5 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | ethane;ethyl 4-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate;formic acid |
| SMILES | CC.CC.CCOC(=O)C1C(=O)NCC1CC(C)C.O=CO |
| InChI | InChI=1S/C11H19NO3.2C2H6.CH2O2/c1-4-15-11(14)9-8(5-7(2)3)6-12-10(9)13;2*1-2;2-1-3/h7-9H,4-6H2,1-3H3,(H,12,13);2*1-2H3;1H,(H,2,3) |
| InChIKey | KDSPAXAEZUFQAJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|