C15H16ClN3O — CID 141179043
5-chloro-N,N-dipyridin-2-ylpentanamide (PubChem CID 141179043) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is 5-chloro-N,N-dipyridin-2-ylpentanamide.
| Compound Name | 5-chloro-N,N-dipyridin-2-ylpentanamide |
|---|---|
| PubChem CID | 141179043 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-chloro-N,N-dipyridin-2-ylpentanamide |
| SMILES | O=C(CCCCCl)N(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C15H16ClN3O/c16-10-4-1-9-15(20)19(13-7-2-5-11-17-13)14-8-3-6-12-18-14/h2-3,5-8,11-12H,1,4,9-10H2 |
| InChIKey | CRFFNDFNOCNYLO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|