C14H14ClN3O — CID 141179045
4-chloro-N,N-dipyridin-2-ylbutanamide (PubChem CID 141179045) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 4-chloro-N,N-dipyridin-2-ylbutanamide.
| Compound Name | 4-chloro-N,N-dipyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 141179045 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 4-chloro-N,N-dipyridin-2-ylbutanamide |
| SMILES | O=C(CCCCl)N(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C14H14ClN3O/c15-9-5-8-14(19)18(12-6-1-3-10-16-12)13-7-2-4-11-17-13/h1-4,6-7,10-11H,5,8-9H2 |
| InChIKey | SGJPFAXTDBFMGG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|