C15H22ClN3O3 — CID 175436427
ethyl 3-[(5-chloropentylamino)-pyridin-2-ylamino]-3-oxopropanoate (PubChem CID 175436427) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is ethyl 3-[(5-chloropentylamino)-pyridin-2-ylamino]-3-oxopropanoate.
| Compound Name | ethyl 3-[(5-chloropentylamino)-pyridin-2-ylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 175436427 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethyl 3-[(5-chloropentylamino)-pyridin-2-ylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)N(NCCCCCCl)c1ccccn1 |
| InChI | InChI=1S/C15H22ClN3O3/c1-2-22-15(21)12-14(20)19(13-8-4-7-10-17-13)18-11-6-3-5-9-16/h4,7-8,10,18H,2-3,5-6,9,11-12H2,1H3 |
| InChIKey | WBJFGSOLUFZWHC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|