C8H8O3 — CID 141179111
4-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (PubChem CID 141179111) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is 4-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
| Compound Name | 4-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 141179111 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 4-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| SMILES | CC1=CC2OC2(C(=O)O)C=C1 |
| InChI | InChI=1S/C8H8O3/c1-5-2-3-8(7(9)10)6(4-5)11-8/h2-4,6H,1H3,(H,9,10) |
| InChIKey | YIYGCGJJJOSSQW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|