C12H21N5O2 — CID 141179172
N-[(2S,3R,4S)-4-azido-2-(diethylaminomethyl)-3,4-dihydro-2H-pyran-3-yl]acetamide (PubChem CID 141179172) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[(2S,3R,4S)-4-azido-2-(diethylaminomethyl)-3,4-dihydro-2H-pyran-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4S)-4-azido-2-(diethylaminomethyl)-3,4-dihydro-2H-pyran-3-yl]acetamide |
|---|---|
| PubChem CID | 141179172 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-[(2S,3R,4S)-4-azido-2-(diethylaminomethyl)-3,4-dihydro-2H-pyran-3-yl]acetamide |
| SMILES | CCN(CC)C[C@@H]1OC=C[C@H](N=[N+]=[N-])[C@H]1NC(C)=O |
| InChI | InChI=1S/C12H21N5O2/c1-4-17(5-2)8-11-12(14-9(3)18)10(15-16-13)6-7-19-11/h6-7,10-12H,4-5,8H2,1-3H3,(H,14,18)/t10-,11-,12+/m0/s1 |
| InChIKey | QMHSXPJSDXDHEJ-SDDRHHMPSA-N |
| XLogP | 1.42 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|