C14H25N3O3 — CID 141179166
N-[(2S,3R,4S)-4-amino-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,4-dihydro-2H-pyran-3-yl]acetamide (PubChem CID 141179166) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[(2S,3R,4S)-4-amino-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,4-dihydro-2H-pyran-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4S)-4-amino-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,4-dihydro-2H-pyran-3-yl]acetamide |
|---|---|
| PubChem CID | 141179166 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N-[(2S,3R,4S)-4-amino-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,4-dihydro-2H-pyran-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](CN2C[C@@H](C)O[C@@H](C)C2)OC=C[C@@H]1N |
| InChI | InChI=1S/C14H25N3O3/c1-9-6-17(7-10(2)20-9)8-13-14(16-11(3)18)12(15)4-5-19-13/h4-5,9-10,12-14H,6-8,15H2,1-3H3,(H,16,18)/t9-,10+,12-,13-,14+/m0/s1 |
| InChIKey | OYZLRRNLMIQXJQ-ONCHEJIZSA-N |
| XLogP | -0.16 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |