C27H27N3O6 — CID 141179361
4,5,6-tris(1,3-benzodioxol-5-ylmethyl)triazinane (PubChem CID 141179361) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is 4,5,6-tris(1,3-benzodioxol-5-ylmethyl)triazinane.
| Compound Name | 4,5,6-tris(1,3-benzodioxol-5-ylmethyl)triazinane |
|---|---|
| PubChem CID | 141179361 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 4,5,6-tris(1,3-benzodioxol-5-ylmethyl)triazinane |
| SMILES | c1cc2c(cc1CC1NNNC(Cc3ccc4c(c3)OCO4)C1Cc1ccc3c(c1)OCO3)OCO2 |
| InChI | InChI=1S/C27H27N3O6/c1-4-22-25(34-13-31-22)10-16(1)7-19-20(8-17-2-5-23-26(11-17)35-14-32-23)28-30-29-21(19)9-18-3-6-24-27(12-18)36-15-33-24/h1-6,10-12,19-21,28-30H,7-9,13-15H2 |
| InChIKey | OSQKMAACAOUTPM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |