C10H10F3NOS — CID 141180792
2-methyl-6-methylsulfanyl-4-(trifluoromethyl)benzamide (PubChem CID 141180792) has the molecular formula C10H10F3NOS and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-methyl-6-methylsulfanyl-4-(trifluoromethyl)benzamide.
| Compound Name | 2-methyl-6-methylsulfanyl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 141180792 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-methyl-6-methylsulfanyl-4-(trifluoromethyl)benzamide |
| SMILES | CSc1cc(C(F)(F)F)cc(C)c1C(N)=O |
| InChI | InChI=1S/C10H10F3NOS/c1-5-3-6(10(11,12)13)4-7(16-2)8(5)9(14)15/h3-4H,1-2H3,(H2,14,15) |
| InChIKey | CADWRBBHRJKKEQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |