C20H11ClF12O3S2 — CID 160775976
2-methylsulfanyl-4,6-bis(trifluoromethyl)benzoic acid;2-methylsulfanyl-4,6-bis(trifluoromethyl)benzoyl chloride (PubChem CID 160775976) has the molecular formula C20H11ClF12O3S2 and a molecular weight of 626.87 g/mol. Its IUPAC name is 2-methylsulfanyl-4,6-bis(trifluoromethyl)benzoic acid;2-methylsulfanyl-4,6-bis(trifluoromethyl)benzoyl chloride.
| Compound Name | 2-methylsulfanyl-4,6-bis(trifluoromethyl)benzoic acid;2-methylsulfanyl-4,6-bis(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 160775976 |
| Molecular Formula | C20H11ClF12O3S2 |
| Molecular Weight | 626.87 g/mol |
| Exact Mass | 625.96 |
| IUPAC Name | 2-methylsulfanyl-4,6-bis(trifluoromethyl)benzoic acid;2-methylsulfanyl-4,6-bis(trifluoromethyl)benzoyl chloride |
| SMILES | CSc1cc(C(F)(F)F)cc(C(F)(F)F)c1C(=O)Cl.CSc1cc(C(F)(F)F)cc(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C10H5ClF6OS.C10H6F6O2S/c1-19-6-3-4(9(12,13)14)2-5(10(15,16)17)7(6)8(11)18;1-19-6-3-4(9(11,12)13)2-5(10(14,15)16)7(6)8(17)18/h2-3H,1H3;2-3H,1H3,(H,17,18) |
| InChIKey | RZYHQEVJRWEPAR-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.87 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|