C9H8F3NO2S — CID 19257215
6-methyl-2-methylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 19257215) has the molecular formula C9H8F3NO2S and a molecular weight of 251.23 g/mol. Its IUPAC name is 6-methyl-2-methylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 6-methyl-2-methylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19257215 |
| Molecular Formula | C9H8F3NO2S |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 6-methyl-2-methylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | CSc1nc(C)cc(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C9H8F3NO2S/c1-4-3-5(9(10,11)12)6(8(14)15)7(13-4)16-2/h3H,1-2H3,(H,14,15) |
| InChIKey | ZUEBLBADOXJMMS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |