C28H50O4 — CID 141183433
bis(4-methylpentyl) 2,3-dicyclohexylbutanedioate (PubChem CID 141183433) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is bis(4-methylpentyl) 2,3-dicyclohexylbutanedioate.
| Compound Name | bis(4-methylpentyl) 2,3-dicyclohexylbutanedioate |
|---|---|
| PubChem CID | 141183433 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | bis(4-methylpentyl) 2,3-dicyclohexylbutanedioate |
| SMILES | CC(C)CCCOC(=O)C(C1CCCCC1)C(C(=O)OCCCC(C)C)C1CCCCC1 |
| InChI | InChI=1S/C28H50O4/c1-21(2)13-11-19-31-27(29)25(23-15-7-5-8-16-23)26(24-17-9-6-10-18-24)28(30)32-20-12-14-22(3)4/h21-26H,5-20H2,1-4H3 |
| InChIKey | YTDFLQZTNGOEPH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|