C7H7N3O3S2 — CID 141183833
2-(5-oxo-2-sulfanylimidazolidin-1-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 141183833) has the molecular formula C7H7N3O3S2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(5-oxo-2-sulfanylimidazolidin-1-yl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(5-oxo-2-sulfanylimidazolidin-1-yl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 141183833 |
| Molecular Formula | C7H7N3O3S2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 2-(5-oxo-2-sulfanylimidazolidin-1-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(N2C(=O)CNC2S)n1 |
| InChI | InChI=1S/C7H7N3O3S2/c11-4-1-8-6(14)10(4)7-9-3(2-15-7)5(12)13/h2,6,8,14H,1H2,(H,12,13) |
| InChIKey | XKTFBVFUVFLRIJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|