C15H16N4O5S3 — CID 141182661
2-[(4-methylphenyl)sulfonylamino]-2-[2-(5-oxo-2-sulfanylimidazolidin-1-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 141182661) has the molecular formula C15H16N4O5S3 and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-2-[2-(5-oxo-2-sulfanylimidazolidin-1-yl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-2-[2-(5-oxo-2-sulfanylimidazolidin-1-yl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 141182661 |
| Molecular Formula | C15H16N4O5S3 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-2-[2-(5-oxo-2-sulfanylimidazolidin-1-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(C(=O)O)c2csc(N3C(=O)CNC3S)n2)cc1 |
| InChI | InChI=1S/C15H16N4O5S3/c1-8-2-4-9(5-3-8)27(23,24)18-12(13(21)22)10-7-26-15(17-10)19-11(20)6-16-14(19)25/h2-5,7,12,14,16,18,25H,6H2,1H3,(H,21,22) |
| InChIKey | HOOULNOUYJJJRE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|