C11H13NO7S — CID 102211028
(2R,3R)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]butanedioic acid (PubChem CID 102211028) has the molecular formula C11H13NO7S and a molecular weight of 303.29 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]butanedioic acid.
| Compound Name | (2R,3R)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 102211028 |
| Molecular Formula | C11H13NO7S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | (2R,3R)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]butanedioic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C(=O)O)[C@@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C11H13NO7S/c1-6-2-4-7(5-3-6)20(18,19)12-8(10(14)15)9(13)11(16)17/h2-5,8-9,12-13H,1H3,(H,14,15)(H,16,17)/t8-,9-/m1/s1 |
| InChIKey | RWHBZXJTXUAQCM-RKDXNWHRSA-N |
| XLogP | -0.83 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |