C24H20N2O8S2 — CID 141184916
4-[4-[4-[(4-sulfophenoxy)amino]phenyl]anilino]oxybenzenesulfonic acid (PubChem CID 141184916) has the molecular formula C24H20N2O8S2 and a molecular weight of 528.56 g/mol. Its IUPAC name is 4-[4-[4-[(4-sulfophenoxy)amino]phenyl]anilino]oxybenzenesulfonic acid.
| Compound Name | 4-[4-[4-[(4-sulfophenoxy)amino]phenyl]anilino]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 141184916 |
| Molecular Formula | C24H20N2O8S2 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 4-[4-[4-[(4-sulfophenoxy)amino]phenyl]anilino]oxybenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(ONc2ccc(-c3ccc(NOc4ccc(S(=O)(=O)O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H20N2O8S2/c27-35(28,29)23-13-9-21(10-14-23)33-25-19-5-1-17(2-6-19)18-3-7-20(8-4-18)26-34-22-11-15-24(16-12-22)36(30,31)32/h1-16,25-26H,(H,27,28,29)(H,30,31,32) |
| InChIKey | OCMHBTKQCLQRRL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|