C15H18ClN5 — CID 141185058
4-(1-benzylpiperazin-2-yl)-6-chloropyrimidin-2-amine (PubChem CID 141185058) has the molecular formula C15H18ClN5 and a molecular weight of 303.80 g/mol. Its IUPAC name is 4-(1-benzylpiperazin-2-yl)-6-chloropyrimidin-2-amine.
| Compound Name | 4-(1-benzylpiperazin-2-yl)-6-chloropyrimidin-2-amine |
|---|---|
| PubChem CID | 141185058 |
| Molecular Formula | C15H18ClN5 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-(1-benzylpiperazin-2-yl)-6-chloropyrimidin-2-amine |
| SMILES | Nc1nc(Cl)cc(C2CNCCN2Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H18ClN5/c16-14-8-12(19-15(17)20-14)13-9-18-6-7-21(13)10-11-4-2-1-3-5-11/h1-5,8,13,18H,6-7,9-10H2,(H2,17,19,20) |
| InChIKey | SNDWKKJGXFEFKU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |