C15H12Cl2N4O2S — CID 141185234
5-(4,6-dichlorotriazin-5-yl)sulfonyl-N,N-dimethylnaphthalen-1-amine (PubChem CID 141185234) has the molecular formula C15H12Cl2N4O2S and a molecular weight of 383.26 g/mol. Its IUPAC name is 5-(4,6-dichlorotriazin-5-yl)sulfonyl-N,N-dimethylnaphthalen-1-amine.
| Compound Name | 5-(4,6-dichlorotriazin-5-yl)sulfonyl-N,N-dimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 141185234 |
| Molecular Formula | C15H12Cl2N4O2S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 5-(4,6-dichlorotriazin-5-yl)sulfonyl-N,N-dimethylnaphthalen-1-amine |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)c3c(Cl)nnnc3Cl)cccc12 |
| InChI | InChI=1S/C15H12Cl2N4O2S/c1-21(2)11-7-3-6-10-9(11)5-4-8-12(10)24(22,23)13-14(16)18-20-19-15(13)17/h3-8H,1-2H3 |
| InChIKey | ZWSPBSDIHJKNHP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |