C20H15NO6 — CID 141185584
1,1-dimethyl-5,8-dioxo-2-(3-phenoxyphenyl)-4,6,7-trioxaspiro[2.5]octane-2-carbonitrile (PubChem CID 141185584) has the molecular formula C20H15NO6 and a molecular weight of 365.34 g/mol. Its IUPAC name is 1,1-dimethyl-5,8-dioxo-2-(3-phenoxyphenyl)-4,6,7-trioxaspiro[2.5]octane-2-carbonitrile.
| Compound Name | 1,1-dimethyl-5,8-dioxo-2-(3-phenoxyphenyl)-4,6,7-trioxaspiro[2.5]octane-2-carbonitrile |
|---|---|
| PubChem CID | 141185584 |
| Molecular Formula | C20H15NO6 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1,1-dimethyl-5,8-dioxo-2-(3-phenoxyphenyl)-4,6,7-trioxaspiro[2.5]octane-2-carbonitrile |
| SMILES | CC1(C)C2(OC(=O)OOC2=O)C1(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H15NO6/c1-18(2)19(12-21,20(18)16(22)26-27-17(23)25-20)13-7-6-10-15(11-13)24-14-8-4-3-5-9-14/h3-11H,1-2H3 |
| InChIKey | UGQFJZGMPBYWKZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|