C21H42 — CID 141187025
3,7,8-trimethyloctadec-2-ene (PubChem CID 141187025) has the molecular formula C21H42 and a molecular weight of 294.57 g/mol. Its IUPAC name is 3,7,8-trimethyloctadec-2-ene.
| Compound Name | 3,7,8-trimethyloctadec-2-ene |
|---|---|
| PubChem CID | 141187025 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | 3,7,8-trimethyloctadec-2-ene |
| SMILES | CC=C(C)CCCC(C)C(C)CCCCCCCCCC |
| InChI | InChI=1S/C21H42/c1-6-8-9-10-11-12-13-14-17-20(4)21(5)18-15-16-19(3)7-2/h7,20-21H,6,8-18H2,1-5H3 |
| InChIKey | KTACBKJSKHQDDC-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|