C21H23N5O5 — CID 141187566
[[4-[[2-(cyclohexylmethylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carbonyl]amino]carbamic acid (PubChem CID 141187566) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is [[4-[[2-(cyclohexylmethylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carbonyl]amino]carbamic acid.
| Compound Name | [[4-[[2-(cyclohexylmethylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carbonyl]amino]carbamic acid |
|---|---|
| PubChem CID | 141187566 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [[4-[[2-(cyclohexylmethylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carbonyl]amino]carbamic acid |
| SMILES | O=C(O)NNC(=O)c1cc(Oc2ccc3nc(NCC4CCCCC4)oc3c2)ccn1 |
| InChI | InChI=1S/C21H23N5O5/c27-19(25-26-21(28)29)17-10-15(8-9-22-17)30-14-6-7-16-18(11-14)31-20(24-16)23-12-13-4-2-1-3-5-13/h6-11,13,26H,1-5,12H2,(H,23,24)(H,25,27)(H,28,29) |
| InChIKey | BLEZLGJNALRHQM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|