C20H23N5O2 — CID 89325818
4-[[2-(cyclohexylmethylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboximidamide (PubChem CID 89325818) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 4-[[2-(cyclohexylmethylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboximidamide.
| Compound Name | 4-[[2-(cyclohexylmethylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 89325818 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 4-[[2-(cyclohexylmethylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Oc2ccc3nc(NCC4CCCCC4)oc3c2)ccn1 |
| InChI | InChI=1S/C20H23N5O2/c21-19(22)17-10-15(8-9-23-17)26-14-6-7-16-18(11-14)27-20(25-16)24-12-13-4-2-1-3-5-13/h6-11,13H,1-5,12H2,(H3,21,22)(H,24,25) |
| InChIKey | NEFPXOKBZNHJOD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|