About 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid
4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid (PubChem CID 142780773) has the molecular formula C18H17N3O5
and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid |
| PubChem CID | 142780773 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Oc2ccc3nc(NC4CCOCC4)oc3c2)ccn1 |
| InChI | InChI=1S/C18H17N3O5/c22-17(23)15-9-13(3-6-19-15)25-12-1-2-14-16(10-12)26-18(21-14)20-11-4-7-24-8-5-11/h1-3,6,9-11H,4-5,7-8H2,(H,20,21)(H,22,23) |
| InChIKey | LANGXQFYVRWRIN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid?
The IUPAC name of 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid (CID 142780773) is 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid.
What is the SMILES notation for 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid?
The canonical SMILES for 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid is O=C(O)c1cc(Oc2ccc3nc(NC4CCOCC4)oc3c2)ccn1.
What is the InChIKey of 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid?
The InChIKey is LANGXQFYVRWRIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O5/c22-17(23)15-9-13(3-6-19-15)25-12-1-2-14-16(10-12)26-18(21-14)20-11-4-7-24-8-5-11/h1-3,6,9-11H,4-5,7-8H2,(H,20,21)(H,22,23).
What are the key properties of 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid?
4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid has a molecular weight of 355.35 g/mol, XLogP of 3.30, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(oxan-4-ylamino)-1,3-benzoxazol-6-yl]oxy]pyridine-2-carboxylic acid is sourced from PubChem (CID 142780773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).