C15H27F3N2OSi — CID 141191317
tert-butyl-dimethyl-[4-[5-(trifluoromethyl)-2H-pyrimidin-1-yl]butoxy]silane (PubChem CID 141191317) has the molecular formula C15H27F3N2OSi and a molecular weight of 336.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-[5-(trifluoromethyl)-2H-pyrimidin-1-yl]butoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4-[5-(trifluoromethyl)-2H-pyrimidin-1-yl]butoxy]silane |
|---|---|
| PubChem CID | 141191317 |
| Molecular Formula | C15H27F3N2OSi |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | tert-butyl-dimethyl-[4-[5-(trifluoromethyl)-2H-pyrimidin-1-yl]butoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCN1C=C(C(F)(F)F)C=NC1 |
| InChI | InChI=1S/C15H27F3N2OSi/c1-14(2,3)22(4,5)21-9-7-6-8-20-11-13(10-19-12-20)15(16,17)18/h10-11H,6-9,12H2,1-5H3 |
| InChIKey | CEXQKWHBDYMLDP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|