C15H28N2OSSi — CID 15419182
tert-butyl-[4-(4,6-dihydrothieno[3,4-d]pyrazol-1-yl)butoxy]-dimethylsilane (PubChem CID 15419182) has the molecular formula C15H28N2OSSi and a molecular weight of 312.56 g/mol. Its IUPAC name is tert-butyl-[4-(4,6-dihydrothieno[3,4-d]pyrazol-1-yl)butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-(4,6-dihydrothieno[3,4-d]pyrazol-1-yl)butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 15419182 |
| Molecular Formula | C15H28N2OSSi |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | tert-butyl-[4-(4,6-dihydrothieno[3,4-d]pyrazol-1-yl)butoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCn1ncc2c1CSC2 |
| InChI | InChI=1S/C15H28N2OSSi/c1-15(2,3)20(4,5)18-9-7-6-8-17-14-12-19-11-13(14)10-16-17/h10H,6-9,11-12H2,1-5H3 |
| InChIKey | OSJFYBOGBRMSED-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|