C28H55ClN4O3Si2 — CID 162255149
tert-butyl-[4-[5-(chloromethyl)pyrazol-1-yl]butoxy]-dimethylsilane;[2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]pyrazol-3-yl]methanol (PubChem CID 162255149) has the molecular formula C28H55ClN4O3Si2 and a molecular weight of 587.40 g/mol. Its IUPAC name is tert-butyl-[4-[5-(chloromethyl)pyrazol-1-yl]butoxy]-dimethylsilane;[2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]pyrazol-3-yl]methanol.
| Compound Name | tert-butyl-[4-[5-(chloromethyl)pyrazol-1-yl]butoxy]-dimethylsilane;[2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]pyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 162255149 |
| Molecular Formula | C28H55ClN4O3Si2 |
| Molecular Weight | 587.40 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | tert-butyl-[4-[5-(chloromethyl)pyrazol-1-yl]butoxy]-dimethylsilane;[2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]pyrazol-3-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCn1nccc1CCl.CC(C)(C)[Si](C)(C)OCCCCn1nccc1CO |
| InChI | InChI=1S/C14H27ClN2OSi.C14H28N2O2Si/c1-14(2,3)19(4,5)18-11-7-6-10-17-13(12-15)8-9-16-17;1-14(2,3)19(4,5)18-11-7-6-10-16-13(12-17)8-9-15-16/h8-9H,6-7,10-12H2,1-5H3;8-9,17H,6-7,10-12H2,1-5H3 |
| InChIKey | ZYMOFCZUAURVRI-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.40 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|