C15H13FN2O2 — CID 141197373
10-amino-7-fluoro-6,11-dihydrobenzo[c][1]benzazepine-5-carboxylic acid (PubChem CID 141197373) has the molecular formula C15H13FN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is 10-amino-7-fluoro-6,11-dihydrobenzo[c][1]benzazepine-5-carboxylic acid.
| Compound Name | 10-amino-7-fluoro-6,11-dihydrobenzo[c][1]benzazepine-5-carboxylic acid |
|---|---|
| PubChem CID | 141197373 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 10-amino-7-fluoro-6,11-dihydrobenzo[c][1]benzazepine-5-carboxylic acid |
| SMILES | Nc1ccc(F)c2c1Cc1ccccc1N(C(=O)O)C2 |
| InChI | InChI=1S/C15H13FN2O2/c16-12-5-6-13(17)10-7-9-3-1-2-4-14(9)18(15(19)20)8-11(10)12/h1-6H,7-8,17H2,(H,19,20) |
| InChIKey | RYOIEYBNYCPQCE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|