C16H27F3O2S — CID 141200503
(4-tert-butylphenyl)-bis(ethoxymethyl)-trifluoro-λ6-sulfane (PubChem CID 141200503) has the molecular formula C16H27F3O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is (4-tert-butylphenyl)-bis(ethoxymethyl)-trifluoro-λ6-sulfane.
| Compound Name | (4-tert-butylphenyl)-bis(ethoxymethyl)-trifluoro-λ6-sulfane |
|---|---|
| PubChem CID | 141200503 |
| Molecular Formula | C16H27F3O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (4-tert-butylphenyl)-bis(ethoxymethyl)-trifluoro-λ6-sulfane |
| SMILES | CCOCS(F)(F)(F)(COCC)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H27F3O2S/c1-6-20-12-22(17,18,19,13-21-7-2)15-10-8-14(9-11-15)16(3,4)5/h8-11H,6-7,12-13H2,1-5H3 |
| InChIKey | IUZNALGQFSNRHG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |