About (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane
(4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane (PubChem CID 141200509) has the molecular formula C12H19F3S
and a molecular weight of 252.34 g/mol. Its IUPAC name is (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane.
Molecular Properties
| Compound Name | (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane |
| PubChem CID | 141200509 |
| Molecular Formula | C12H19F3S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane |
| SMILES | CC(C)(C)c1ccc(S(C)(C)(F)(F)F)cc1 |
| InChI | InChI=1S/C12H19F3S/c1-12(2,3)10-6-8-11(9-7-10)16(4,5,13,14)15/h6-9H,1-5H3 |
| InChIKey | OGPFSJNVEPWIAG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane?
The IUPAC name of (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane (CID 141200509) is (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane.
What is the SMILES notation for (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane?
The canonical SMILES for (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane is CC(C)(C)c1ccc(S(C)(C)(F)(F)F)cc1.
What is the InChIKey of (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane?
The InChIKey is OGPFSJNVEPWIAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3S/c1-12(2,3)10-6-8-11(9-7-10)16(4,5,13,14)15/h6-9H,1-5H3.
What are the key properties of (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane?
(4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane has a molecular weight of 252.34 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl)-trifluoro-dimethyl-λ6-sulfane is sourced from PubChem (CID 141200509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).