C18H25NO2 — CID 141200524
3-(2,5-dimethylphenyl)-8-methoxy-1-azaspiro[4.5]dec-3-en-4-ol (PubChem CID 141200524) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-8-methoxy-1-azaspiro[4.5]dec-3-en-4-ol.
| Compound Name | 3-(2,5-dimethylphenyl)-8-methoxy-1-azaspiro[4.5]dec-3-en-4-ol |
|---|---|
| PubChem CID | 141200524 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-8-methoxy-1-azaspiro[4.5]dec-3-en-4-ol |
| SMILES | COC1CCC2(CC1)NCC(c1cc(C)ccc1C)=C2O |
| InChI | InChI=1S/C18H25NO2/c1-12-4-5-13(2)15(10-12)16-11-19-18(17(16)20)8-6-14(21-3)7-9-18/h4-5,10,14,19-20H,6-9,11H2,1-3H3 |
| InChIKey | JEWBPUFBXIVAEN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |