C15H16O4 — CID 141201136
methyl 3-(1-methoxy-4-methyl-1-oxopenta-2,3-dien-2-yl)benzoate (PubChem CID 141201136) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl 3-(1-methoxy-4-methyl-1-oxopenta-2,3-dien-2-yl)benzoate.
| Compound Name | methyl 3-(1-methoxy-4-methyl-1-oxopenta-2,3-dien-2-yl)benzoate |
|---|---|
| PubChem CID | 141201136 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | methyl 3-(1-methoxy-4-methyl-1-oxopenta-2,3-dien-2-yl)benzoate |
| SMILES | COC(=O)C(=C=C(C)C)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C15H16O4/c1-10(2)8-13(15(17)19-4)11-6-5-7-12(9-11)14(16)18-3/h5-7,9H,1-4H3 |
| InChIKey | NBUGIQXWRYICPD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|