C10H22Cl2N2O2S2 — CID 141201230
methyl 3-[(3-imino-3-methoxypropyl)disulfanyl]-2,2-dimethylpropanimidate;dihydrochloride (PubChem CID 141201230) has the molecular formula C10H22Cl2N2O2S2 and a molecular weight of 337.34 g/mol. Its IUPAC name is methyl 3-[(3-imino-3-methoxypropyl)disulfanyl]-2,2-dimethylpropanimidate;dihydrochloride.
| Compound Name | methyl 3-[(3-imino-3-methoxypropyl)disulfanyl]-2,2-dimethylpropanimidate;dihydrochloride |
|---|---|
| PubChem CID | 141201230 |
| Molecular Formula | C10H22Cl2N2O2S2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | methyl 3-[(3-imino-3-methoxypropyl)disulfanyl]-2,2-dimethylpropanimidate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(/CCSSCC(C)(C)/C(=N/[H])OC)OC |
| InChI | InChI=1S/C10H20N2O2S2.2ClH/c1-10(2,9(12)14-4)7-16-15-6-5-8(11)13-3;;/h11-12H,5-7H2,1-4H3;2*1H/b11-8-,12-9-;; |
| InChIKey | ADBCEPUNTOHGIY-SYFIXNPISA-N |
| XLogP | 3.88 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|