dimethyl 2,2-dimethylhexanediimidate

C10H20N2O2 — CID 175029785

IUPACdimethyl 2,2-dimethylhexanediimidate
SMILES[H]/N=C(/CCCC(C)(C)/C(=N/[H])OC)OC
InChIInChI=1S/C10H20N2O2/c1-10(2,9(12)14-4)7-5-6-8(11)13-3/h11-12H,5-7H2,1-4H3/b11-8-,12-9-
InChIKeyLQCQBGQMRDCRQW-QAHSQZNUSA-N
MW200.28 g/mol
LogP2.43
Rot. Bonds5

About dimethyl 2,2-dimethylhexanediimidate

dimethyl 2,2-dimethylhexanediimidate (PubChem CID 175029785) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is dimethyl 2,2-dimethylhexanediimidate.

Molecular Properties

Compound Namedimethyl 2,2-dimethylhexanediimidate
PubChem CID175029785
Molecular FormulaC10H20N2O2
Molecular Weight200.28 g/mol
Exact Mass200.15
IUPAC Namedimethyl 2,2-dimethylhexanediimidate
SMILES[H]/N=C(/CCCC(C)(C)/C(=N/[H])OC)OC
InChIInChI=1S/C10H20N2O2/c1-10(2,9(12)14-4)7-5-6-8(11)13-3/h11-12H,5-7H2,1-4H3/b11-8-,12-9-
InChIKeyLQCQBGQMRDCRQW-QAHSQZNUSA-N
XLogP2.43
TPSA66.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 52.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze dimethyl 2,2-dimethylhexanediimidate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethyl 2,2-dimethylhexanediimidate?
The IUPAC name of dimethyl 2,2-dimethylhexanediimidate (CID 175029785) is dimethyl 2,2-dimethylhexanediimidate.
What is the SMILES notation for dimethyl 2,2-dimethylhexanediimidate?
The canonical SMILES for dimethyl 2,2-dimethylhexanediimidate is [H]/N=C(/CCCC(C)(C)/C(=N/[H])OC)OC.
What is the InChIKey of dimethyl 2,2-dimethylhexanediimidate?
The InChIKey is LQCQBGQMRDCRQW-QAHSQZNUSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-10(2,9(12)14-4)7-5-6-8(11)13-3/h11-12H,5-7H2,1-4H3/b11-8-,12-9-.
What are the key properties of dimethyl 2,2-dimethylhexanediimidate?
dimethyl 2,2-dimethylhexanediimidate has a molecular weight of 200.28 g/mol, XLogP of 2.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2,2-dimethylhexanediimidate is sourced from PubChem (CID 175029785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).