C13H18F3NO — CID 141203013
2-(aminomethyl)-1,1,1-trifluoro-4-methyl-4-phenylpentan-2-ol (PubChem CID 141203013) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-(aminomethyl)-1,1,1-trifluoro-4-methyl-4-phenylpentan-2-ol.
| Compound Name | 2-(aminomethyl)-1,1,1-trifluoro-4-methyl-4-phenylpentan-2-ol |
|---|---|
| PubChem CID | 141203013 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-(aminomethyl)-1,1,1-trifluoro-4-methyl-4-phenylpentan-2-ol |
| SMILES | CC(C)(CC(O)(CN)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H18F3NO/c1-11(2,10-6-4-3-5-7-10)8-12(18,9-17)13(14,15)16/h3-7,18H,8-9,17H2,1-2H3 |
| InChIKey | VEJUDIBOWDJGMC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |