About 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate
3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate (PubChem CID 141204762) has the molecular formula C17H39Cl2NO2
and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate.
Molecular Properties
| Compound Name | 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate |
| PubChem CID | 141204762 |
| Molecular Formula | C17H39Cl2NO2 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate |
| SMILES | CCCCCCCCCC(Cl)CC[N+](C)(C)CC(C)O.O.[Cl-] |
| InChI | InChI=1S/C17H37ClNO.ClH.H2O/c1-5-6-7-8-9-10-11-12-17(18)13-14-19(3,4)15-16(2)20;;/h16-17,20H,5-15H2,1-4H3;1H;1H2/q+1;;/p-1 |
| InChIKey | KYAIZLOFZKNZMG-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate?
The IUPAC name of 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate (CID 141204762) is 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate.
What is the SMILES notation for 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate?
The canonical SMILES for 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate is CCCCCCCCCC(Cl)CC[N+](C)(C)CC(C)O.O.[Cl-].
What is the InChIKey of 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate?
The InChIKey is KYAIZLOFZKNZMG-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H37ClNO.ClH.H2O/c1-5-6-7-8-9-10-11-12-17(18)13-14-19(3,4)15-16(2)20;;/h16-17,20H,5-15H2,1-4H3;1H;1H2/q+1;;/p-1.
What are the key properties of 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate?
3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate has a molecular weight of 360.41 g/mol, XLogP of 0.76, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorododecyl-(2-hydroxypropyl)-dimethylazanium;chloride;hydrate is sourced from PubChem (CID 141204762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).