C16H11ClF3NO3S — CID 141206554
(4-chloro-5-methoxy-2-methylindol-1-yl)-[5-(trifluoromethoxy)thiophen-3-yl]methanone (PubChem CID 141206554) has the molecular formula C16H11ClF3NO3S and a molecular weight of 389.78 g/mol. Its IUPAC name is (4-chloro-5-methoxy-2-methylindol-1-yl)-[5-(trifluoromethoxy)thiophen-3-yl]methanone.
| Compound Name | (4-chloro-5-methoxy-2-methylindol-1-yl)-[5-(trifluoromethoxy)thiophen-3-yl]methanone |
|---|---|
| PubChem CID | 141206554 |
| Molecular Formula | C16H11ClF3NO3S |
| Molecular Weight | 389.78 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | (4-chloro-5-methoxy-2-methylindol-1-yl)-[5-(trifluoromethoxy)thiophen-3-yl]methanone |
| SMILES | COc1ccc2c(cc(C)n2C(=O)c2csc(OC(F)(F)F)c2)c1Cl |
| InChI | InChI=1S/C16H11ClF3NO3S/c1-8-5-10-11(3-4-12(23-2)14(10)17)21(8)15(22)9-6-13(25-7-9)24-16(18,19)20/h3-7H,1-2H3 |
| InChIKey | PBAKJJISEVZXMG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.78 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |