C12H9ClN2OS — CID 141207781
[2-(6-chloro-1H-indol-2-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 141207781) has the molecular formula C12H9ClN2OS and a molecular weight of 264.74 g/mol. Its IUPAC name is [2-(6-chloro-1H-indol-2-yl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(6-chloro-1H-indol-2-yl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 141207781 |
| Molecular Formula | C12H9ClN2OS |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | [2-(6-chloro-1H-indol-2-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1cnc(-c2cc3ccc(Cl)cc3[nH]2)s1 |
| InChI | InChI=1S/C12H9ClN2OS/c13-8-2-1-7-3-11(15-10(7)4-8)12-14-5-9(6-16)17-12/h1-5,15-16H,6H2 |
| InChIKey | ADHQDWVHKJNXTN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |