C8H6O5 — CID 141208233
7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid (PubChem CID 141208233) has the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid.
| Compound Name | 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid |
|---|---|
| PubChem CID | 141208233 |
| Molecular Formula | C8H6O5 |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid |
| SMILES | O=C(O)C1=CC=CC2(C(=O)O)OC12 |
| InChI | InChI=1S/C8H6O5/c9-6(10)4-2-1-3-8(7(11)12)5(4)13-8/h1-3,5H,(H,9,10)(H,11,12) |
| InChIKey | FRRZWMRAXACFLA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|