C28H20Cl2NOP — CID 141208846
2-(dichlorophosphorylmethyl)-3,4,5-triphenylquinoline (PubChem CID 141208846) has the molecular formula C28H20Cl2NOP and a molecular weight of 488.35 g/mol. Its IUPAC name is 2-(dichlorophosphorylmethyl)-3,4,5-triphenylquinoline.
| Compound Name | 2-(dichlorophosphorylmethyl)-3,4,5-triphenylquinoline |
|---|---|
| PubChem CID | 141208846 |
| Molecular Formula | C28H20Cl2NOP |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 2-(dichlorophosphorylmethyl)-3,4,5-triphenylquinoline |
| SMILES | O=P(Cl)(Cl)Cc1nc2cccc(-c3ccccc3)c2c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H20Cl2NOP/c29-33(30,32)19-25-26(21-13-6-2-7-14-21)27(22-15-8-3-9-16-22)28-23(17-10-18-24(28)31-25)20-11-4-1-5-12-20/h1-18H,19H2 |
| InChIKey | CJRVIWPSXDIVOO-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|