About CID 159108391
CID 159108391 (PubChem CID 159108391) has the molecular formula C33H23AlN
and a molecular weight of 460.54 g/mol.
Molecular Properties
| Compound Name | CID 159108391 |
| PubChem CID | 159108391 |
| Molecular Formula | C33H23AlN |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | — |
| SMILES | [Al].c1ccc(-c2nc3cccc(-c4ccccc4)c3c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H23N.Al/c1-5-14-24(15-6-1)28-22-13-23-29-32(28)30(25-16-7-2-8-17-25)31(26-18-9-3-10-19-26)33(34-29)27-20-11-4-12-21-27;/h1-23H; |
| InChIKey | KEEGAKAIJJNGEE-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 159108391 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159108391?
The IUPAC name of CID 159108391 (CID 159108391) is not available.
What is the SMILES notation for CID 159108391?
The canonical SMILES for CID 159108391 is [Al].c1ccc(-c2nc3cccc(-c4ccccc4)c3c(-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of CID 159108391?
The InChIKey is KEEGAKAIJJNGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H23N.Al/c1-5-14-24(15-6-1)28-22-13-23-29-32(28)30(25-16-7-2-8-17-25)31(26-18-9-3-10-19-26)33(34-29)27-20-11-4-12-21-27;/h1-23H;.
What are the key properties of CID 159108391?
CID 159108391 has a molecular weight of 460.54 g/mol, XLogP of 8.52, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159108391 is sourced from PubChem (CID 159108391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).