C19H22O2 — CID 141214780
2-[3-(2,5-dimethylphenoxy)phenyl]pent-4-en-2-ol (PubChem CID 141214780) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[3-(2,5-dimethylphenoxy)phenyl]pent-4-en-2-ol.
| Compound Name | 2-[3-(2,5-dimethylphenoxy)phenyl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 141214780 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-[3-(2,5-dimethylphenoxy)phenyl]pent-4-en-2-ol |
| SMILES | C=CCC(C)(O)c1cccc(Oc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C19H22O2/c1-5-11-19(4,20)16-7-6-8-17(13-16)21-18-12-14(2)9-10-15(18)3/h5-10,12-13,20H,1,11H2,2-4H3 |
| InChIKey | RDLRPSXLDWHABE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|