C12H13F2IO2 — CID 170551592
1,1-difluoro-1-iodo-2-(3-methoxyphenyl)pent-4-en-2-ol (PubChem CID 170551592) has the molecular formula C12H13F2IO2 and a molecular weight of 354.13 g/mol. Its IUPAC name is 1,1-difluoro-1-iodo-2-(3-methoxyphenyl)pent-4-en-2-ol.
| Compound Name | 1,1-difluoro-1-iodo-2-(3-methoxyphenyl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 170551592 |
| Molecular Formula | C12H13F2IO2 |
| Molecular Weight | 354.13 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 1,1-difluoro-1-iodo-2-(3-methoxyphenyl)pent-4-en-2-ol |
| SMILES | C=CCC(O)(c1cccc(OC)c1)C(F)(F)I |
| InChI | InChI=1S/C12H13F2IO2/c1-3-7-11(16,12(13,14)15)9-5-4-6-10(8-9)17-2/h3-6,8,16H,1,7H2,2H3 |
| InChIKey | WVNWPRWPTMPXQY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.13 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|