C9H7F2IO2 — CID 175177821
2,2-difluoro-2-(3-methoxyphenyl)acetyl iodide (PubChem CID 175177821) has the molecular formula C9H7F2IO2 and a molecular weight of 312.05 g/mol. Its IUPAC name is 2,2-difluoro-2-(3-methoxyphenyl)acetyl iodide.
| Compound Name | 2,2-difluoro-2-(3-methoxyphenyl)acetyl iodide |
|---|---|
| PubChem CID | 175177821 |
| Molecular Formula | C9H7F2IO2 |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 2,2-difluoro-2-(3-methoxyphenyl)acetyl iodide |
| SMILES | COc1cccc(C(F)(F)C(=O)I)c1 |
| InChI | InChI=1S/C9H7F2IO2/c1-14-7-4-2-3-6(5-7)9(10,11)8(12)13/h2-5H,1H3 |
| InChIKey | XRHYUBBOJVLVSE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|