C23H23NO4 — CID 174763658
2,2,2-tris(3-methoxyphenyl)acetamide (PubChem CID 174763658) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2,2,2-tris(3-methoxyphenyl)acetamide.
| Compound Name | 2,2,2-tris(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 174763658 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2,2,2-tris(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(C(C(N)=O)(c2cccc(OC)c2)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C23H23NO4/c1-26-19-10-4-7-16(13-19)23(22(24)25,17-8-5-11-20(14-17)27-2)18-9-6-12-21(15-18)28-3/h4-15H,1-3H3,(H2,24,25) |
| InChIKey | SVBUWPGCCSOKDF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|