C22H23ClN2O — CID 141215134
4-benzyl-3-(4-chloro-3-methylphenyl)-2,4,5,6,7,8-hexahydrophthalazin-1-one (PubChem CID 141215134) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-benzyl-3-(4-chloro-3-methylphenyl)-2,4,5,6,7,8-hexahydrophthalazin-1-one.
| Compound Name | 4-benzyl-3-(4-chloro-3-methylphenyl)-2,4,5,6,7,8-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 141215134 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-benzyl-3-(4-chloro-3-methylphenyl)-2,4,5,6,7,8-hexahydrophthalazin-1-one |
| SMILES | Cc1cc(N2NC(=O)C3=C(CCCC3)C2Cc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C22H23ClN2O/c1-15-13-17(11-12-20(15)23)25-21(14-16-7-3-2-4-8-16)18-9-5-6-10-19(18)22(26)24-25/h2-4,7-8,11-13,21H,5-6,9-10,14H2,1H3,(H,24,26) |
| InChIKey | LGDCQVISZZPHGW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |